![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | Power Drift (1989)(Activision)(US)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 1.6K | |
![[ ]](/icons/compressed.gif) | Gusano (1985)(Advance)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 1.6K | |
![[ ]](/icons/compressed.gif) | Smash (1984)(Spectravideo)(GB)[CLOAD + RUN].zip | 2020-12-31 15:06 | 1.8K | |
![[ ]](/icons/compressed.gif) | Vicious Viper (1985)(Sanyo)(JP)(en)[a2][CLOAD][no Sanyo title screen].zip | 2020-12-31 15:06 | 2.2K | |
![[ ]](/icons/compressed.gif) | Gusano (1985)(Advance)(ES)[CLOAD + RUN].zip | 2020-12-31 15:06 | 2.3K | |
![[ ]](/icons/compressed.gif) | Vicious Viper (1985)(Sanyo)(JP)(en)[CLOAD].zip | 2020-12-31 15:06 | 2.4K | |
![[ ]](/icons/compressed.gif) | Vicious Viper (1985)(Sanyo)(JP)(en)[a][CLOAD].zip | 2020-12-31 15:06 | 2.4K | |
![[ ]](/icons/compressed.gif) | Exploding Atoms (1985)(Sanyo)(JP)[a2][CLOAD + RUN].zip | 2020-12-31 15:06 | 2.6K | |
![[ ]](/icons/compressed.gif) | Exploding Atoms (1985)(Sanyo)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 2.8K | |
![[ ]](/icons/compressed.gif) | Exploding Atoms (1985)(Sanyo)(JP)[a][CLOAD + RUN].zip | 2020-12-31 15:06 | 2.8K | |
![[ ]](/icons/compressed.gif) | Lazer Bykes (1985)(PSS)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 3.4K | |
![[ ]](/icons/compressed.gif) | Horse Race. Carreras de caballos (1983)(Spectravideo)(GB)(es)[CLOAD][Martos].zip | 2020-12-31 15:06 | 3.5K | |
![[ ]](/icons/compressed.gif) | Frog (1985)(Advance)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 3.6K | |
![[ ]](/icons/compressed.gif) | Reflex (1987)(Players Software)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 3.6K | |
![[ ]](/icons/compressed.gif) | Laberinto (1985)(Advance)(ES)[CLOAD + RUN].zip | 2020-12-31 15:06 | 3.6K | |
![[ ]](/icons/compressed.gif) | Way of the Tiger, The (1986)(Gremlin Graphics Software)(GB)(Tape 1 of 2 Side A)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 3.6K | |
![[ ]](/icons/compressed.gif) | Karateka (1986)(Dro Soft)(ES)(Side B)[Martos].zip | 2020-12-31 15:06 | 3.9K | |
![[ ]](/icons/compressed.gif) | Wallball (19xx)(Tynesoft)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 3.9K | |
![[ ]](/icons/compressed.gif) | Wallball (19xx)(Tynesoft)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 3.9K | |
![[ ]](/icons/compressed.gif) | Lazer Bykes (1985)(PSS)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 3.9K | |
![[ ]](/icons/compressed.gif) | Lazer Bykes (1985)(PSS)(GB)[a2][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 3.9K | |
![[ ]](/icons/compressed.gif) | Battle Ship Clapton II (1984)(Toshiba)(JP)(en)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 4.0K | |
![[ ]](/icons/compressed.gif) | Space Walk (1985)(Mastertronic)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 4.0K | |
![[ ]](/icons/compressed.gif) | Mini-Golf (1984)(Advance)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 4.2K | |
![[ ]](/icons/compressed.gif) | Space Busters (1985)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 4.2K | |
![[ ]](/icons/compressed.gif) | Most Amazing Memory Game, The (1986)(Idealogic)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 4.2K | |
![[ ]](/icons/compressed.gif) | Grid Trap (1985)(Livewire Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 4.5K | |
![[ ]](/icons/compressed.gif) | Grid Trap (1985)(Livewire Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 4.5K | |
![[ ]](/icons/compressed.gif) | Fruit Machine (1985)(DK'Tronics)(GB)[CLOAD + RUN].zip | 2020-12-31 15:06 | 4.8K | |
![[ ]](/icons/compressed.gif) | Vacuumania (1984)(PSS)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 4.9K | |
![[ ]](/icons/compressed.gif) | Vacuumania (1984)(PSS)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 4.9K | |
![[ ]](/icons/compressed.gif) | Forbidden Fruit (1985)(Mind Games Espana)(ES)[CLOAD + RUN].zip | 2020-12-31 15:06 | 4.9K | |
![[ ]](/icons/compressed.gif) | Bit Byter (19xx)(Spectravideo)(GB)[CLOAD + RUN].zip | 2020-12-31 15:06 | 4.9K | |
![[ ]](/icons/compressed.gif) | Humphrey (1984)(Mr. Micro)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 4.9K | |
![[ ]](/icons/compressed.gif) | Humphrey (1984)(Mr. Micro)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 4.9K | |
![[ ]](/icons/compressed.gif) | Pico Pico (1983)(Micro Cabin)(JP)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 5.0K | |
![[ ]](/icons/compressed.gif) | Comecocos (19xx)(Idealogic)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 5.0K | |
![[ ]](/icons/compressed.gif) | Reflex (1987)(Players Software)(GB)(Side B)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 5.0K | |
![[ ]](/icons/compressed.gif) | Flight Path 737 (1985)(Anirog Software)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 5.1K | |
![[ ]](/icons/compressed.gif) | Reflex (1987)(Players Software)(GB)(Side B)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 5.1K | |
![[ ]](/icons/compressed.gif) | Pico Pico (1983)(Micro Cabin)(JP)[RUN'CAS-'].zip | 2020-12-31 15:06 | 5.1K | |
![[ ]](/icons/compressed.gif) | Pyramid Warp (1983)(T&E Soft)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 5.1K | |
![[ ]](/icons/compressed.gif) | Crazy Golf (1984)(Mr. Micro)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 5.2K | |
![[ ]](/icons/compressed.gif) | Fall Out (1984)(Policy)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 5.3K | |
![[ ]](/icons/compressed.gif) | Castle Combat (1985)(Spectravideo)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 5.4K | |
![[ ]](/icons/compressed.gif) | Cubit (1986)(Mr. Micro)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 5.5K | |
![[ ]](/icons/compressed.gif) | Cubit (1986)(Mr. Micro)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 5.5K | |
![[ ]](/icons/compressed.gif) | Sootland (1988)(Zafiro Software Division)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 5.5K | |
![[ ]](/icons/compressed.gif) | Darts (1987)(Blue Ribbon Software)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 5.7K | |
![[ ]](/icons/compressed.gif) | Gang Man (1988)(Armati Software)[RUN'CAS-'].zip | 2020-12-31 15:06 | 5.9K | |
![[ ]](/icons/compressed.gif) | Bop! (1986)(Bug-Byte Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 5.9K | |
![[ ]](/icons/compressed.gif) | Survivors (1986)(Atlantis Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 6.1K | |
![[ ]](/icons/compressed.gif) | Skate Dragon (1986)(Idealogic)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 6.3K | |
![[ ]](/icons/compressed.gif) | Skate Dragon (1986)(Idealogic)(ES)[b][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 6.3K | |
![[ ]](/icons/compressed.gif) | Night Flight (1982)(Nippon Columbia - Colpax - Universal)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 6.3K | |
![[ ]](/icons/compressed.gif) | Cavern of Death (1987)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 6.4K | |
![[ ]](/icons/compressed.gif) | Miner Machine (1987)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 6.6K | |
![[ ]](/icons/compressed.gif) | Mr. Wong's Loopy Laundry (1984)(Artic Computing)(GB)[b2][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 6.6K | |
![[ ]](/icons/compressed.gif) | Mr. Wong's Loopy Laundry (1984)(Artic Computing)(GB)[b][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 6.6K | |
![[ ]](/icons/compressed.gif) | Miner Machine (1987)(Eaglesoft)(NL)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 6.6K | |
![[ ]](/icons/compressed.gif) | Miner Machine (1987)(Eaglesoft)(NL)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 6.6K | |
![[ ]](/icons/compressed.gif) | Igloo (1985)(Garbi Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 6.6K | |
![[ ]](/icons/compressed.gif) | Stop Ball (1987)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 6.7K | |
![[ ]](/icons/compressed.gif) | Astro Plumber (1986)(Blue Ribbon Software)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 6.8K | |
![[ ]](/icons/compressed.gif) | Master Chess (1987)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 6.9K | |
![[ ]](/icons/compressed.gif) | Master Chess (1987)(Mastertronic)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 6.9K | |
![[ ]](/icons/compressed.gif) | Domino (1985)(DIMensionNEW)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 6.9K | |
![[ ]](/icons/compressed.gif) | Domino (1985)(DIMensionNEW)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 6.9K | |
![[ ]](/icons/compressed.gif) | Boardello (1985)(Bubble Bus Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 6.9K | |
![[ ]](/icons/compressed.gif) | Mr. Wong's Loopy Laundry (1984)(Artic Computing)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.0K | |
![[ ]](/icons/compressed.gif) | Budokan (1991)(Dro Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 7.0K | |
![[ ]](/icons/compressed.gif) | Foot Volley (1986)(Players Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 7.0K | |
![[ ]](/icons/compressed.gif) | Bytebusters (1984)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 7.1K | |
![[ ]](/icons/compressed.gif) | Hunchback (1984)(Ocean Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.1K | |
![[ ]](/icons/compressed.gif) | Mr. Wong's Loopy Laundry (1984)(Artic Computing)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.1K | |
![[ ]](/icons/compressed.gif) | Tetris (1987)(Mirrorsoft)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 7.1K | |
![[ ]](/icons/compressed.gif) | Hunchback (1984)(Ocean Software)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.1K | |
![[ ]](/icons/compressed.gif) | Steve Davis Snooker (1985)(CDS Microsystems)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 7.1K | |
![[ ]](/icons/compressed.gif) | Vestron (1986)(Players Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.1K | |
![[ ]](/icons/compressed.gif) | Vestron (1986)(Players Software)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.2K | |
![[ ]](/icons/compressed.gif) | Dog Fighter (1986)(Sony)(JP)[HBJ-G020T][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.2K | |
![[ ]](/icons/compressed.gif) | Dog Fighter (1986)(Kuma Computers)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.2K | |
![[ ]](/icons/compressed.gif) | Boom (1986)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 7.4K | |
![[ ]](/icons/compressed.gif) | Budokan (1991)(Dro Soft)(ES)(Side C)[RUN'CAS-'].zip | 2020-12-31 15:06 | 7.5K | |
![[ ]](/icons/compressed.gif) | Mayhem (1985)(Mr. Micro)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.5K | |
![[ ]](/icons/compressed.gif) | Shup - Trebol (1986)(Mind Games Espana)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.5K | |
![[ ]](/icons/compressed.gif) | War Chess (1986)(Idealogic)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 7.5K | |
![[ ]](/icons/compressed.gif) | Champ (1984)(PSS)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.6K | |
![[ ]](/icons/compressed.gif) | Super Cross Force (1983)(Spectravideo)(GB)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 7.7K | |
![[ ]](/icons/compressed.gif) | Hustler (1984)(Bubble Bus Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.7K | |
![[ ]](/icons/compressed.gif) | Matamarcianos. Batalla Espacial (1986)(Manhattan Transfer)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 7.7K | |
![[ ]](/icons/compressed.gif) | Heat Seeker - Missil (1986)(Mind Games Espana)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 7.8K | |
![[ ]](/icons/compressed.gif) | Invaders (1986)(Livewire Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 7.8K | |
![[ ]](/icons/compressed.gif) | Krypton (1986)(Manhattan Transfer)(ES)[CLOAD + RUN].zip | 2020-12-31 15:06 | 7.8K | |
![[ ]](/icons/compressed.gif) | Zexas (1984)(dB-Soft)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 7.8K | |
![[ ]](/icons/compressed.gif) | Alpha Blaster (1984)(Aackosoft)(NL)[a2][RUN'CAS-'][1st edition].zip | 2020-12-31 15:06 | 7.9K | |
![[ ]](/icons/compressed.gif) | Alpha Blaster (1984)(Aackosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 7.9K | |
![[ ]](/icons/compressed.gif) | Slapshot (1985)(Anirog Software)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 8.0K | |
![[ ]](/icons/compressed.gif) | Star Runner (1986)(Manhattan Transfer)(ES)[b][RUN'CAS-'].zip | 2020-12-31 15:06 | 8.0K | |
![[ ]](/icons/compressed.gif) | 3D Golf Simulation - High Speed Edition (1984)(T&E Soft)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 8.1K | |
![[ ]](/icons/compressed.gif) | Oh Mummy!! (1984)(Longman Software)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 8.1K | |
![[ ]](/icons/compressed.gif) | Shnax (1985)(Kuma Computers)(GB)[RUN'CAS-',R][Martos].zip | 2020-12-31 15:06 | 8.2K | |
![[ ]](/icons/compressed.gif) | Time Bandits (1984)(PSS)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 8.2K | |
![[ ]](/icons/compressed.gif) | Time Bandits (1984)(PSS)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 8.2K | |
![[ ]](/icons/compressed.gif) | Star Runner (1986)(Manhattan Transfer)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 8.3K | |
![[ ]](/icons/compressed.gif) | Trick Boy. Pinball (1984)(T&E Soft)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 8.3K | |
![[ ]](/icons/compressed.gif) | Star Runner (1986)(Manhattan Transfer)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 8.3K | |
![[ ]](/icons/compressed.gif) | Winter Olympics (1986)(Tynesoft)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 8.3K | |
![[ ]](/icons/compressed.gif) | Astro Blaster (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 8.4K | |
![[ ]](/icons/compressed.gif) | Alpha Blaster (1987)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 8.4K | |
![[ ]](/icons/compressed.gif) | Alpha Blaster (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 8.4K | |
![[ ]](/icons/compressed.gif) | Gangman (1984)(Hudson Soft)(JP)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 8.5K | |
![[ ]](/icons/compressed.gif) | Gangman (1984)(Hudson Soft)(JP)[RUN'CAS-'].zip | 2020-12-31 15:06 | 8.5K | |
![[ ]](/icons/compressed.gif) | Exterminator (1987)(Eaglesoft)(NL)(en)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 8.5K | |
![[ ]](/icons/compressed.gif) | Sky War (1988)(OMK Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 8.5K | |
![[ ]](/icons/compressed.gif) | Winter Olympics (1986)(Tynesoft)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 8.6K | |
![[ ]](/icons/compressed.gif) | Blagger (1984)(Alligata Software)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 8.6K | |
![[ ]](/icons/compressed.gif) | Death Valley Gold Rush (1985)(Kuma Computers)(GB)[CLOAD + RUN].zip | 2020-12-31 15:06 | 8.6K | |
![[ ]](/icons/compressed.gif) | Ananas (1989)(Eurosoft)(NL)[aka Pine Applin][RUN'CAS-'].zip | 2020-12-31 15:06 | 8.8K | |
![[ ]](/icons/compressed.gif) | Maxima (1984)(PSS)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 8.9K | |
![[ ]](/icons/compressed.gif) | Maxima (1984)(PSS)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 8.9K | |
![[ ]](/icons/compressed.gif) | Oil's Well (1985)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 8.9K | |
![[ ]](/icons/compressed.gif) | Hot Shoe (1984)(Longman Software)(GB)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 9.0K | |
![[ ]](/icons/compressed.gif) | Skate Dragon (1986)(Idealogic)(ES)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 9.0K | |
![[ ]](/icons/compressed.gif) | Boulder Dash II - Rockford's Riot (1986)(Databyte)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 9.1K | |
![[ ]](/icons/compressed.gif) | Skull Exilon (1988)(Iber Soft)(ES)[aka Safari X][RUN'CAS-'].zip | 2020-12-31 15:06 | 9.3K | |
![[ ]](/icons/compressed.gif) | Flics, Les (1985)(PSS)(GB)[b][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 9.3K | |
![[ ]](/icons/compressed.gif) | Flics, Les (1985)(PSS)(GB)[b2][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 9.3K | |
![[ ]](/icons/compressed.gif) | Rampart, The (1988)(Iber Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.3K | |
![[ ]](/icons/compressed.gif) | Reflex (1987)(Players Software)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.4K | |
![[ ]](/icons/compressed.gif) | Reflex (1987)(Players Software)(GB)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 9.4K | |
![[ ]](/icons/compressed.gif) | Reflex (1987)(Players Software)(GB)(Side A)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 9.4K | |
![[ ]](/icons/compressed.gif) | Boom (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.4K | |
![[ ]](/icons/compressed.gif) | Boulder Dash (1985)(Databyte)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 9.4K | |
![[ ]](/icons/compressed.gif) | Boulder Dash (1985)(Databyte)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.4K | |
![[ ]](/icons/compressed.gif) | Wall, The (1987)(Erbe Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.5K | |
![[ ]](/icons/compressed.gif) | U-Boot (1985)(Manhattan Transfer)(ES)[a][CLOAD + RUN].zip | 2020-12-31 15:06 | 9.5K | |
![[ ]](/icons/compressed.gif) | Boardello (1985)(Bubble Bus Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 9.5K | |
![[ ]](/icons/compressed.gif) | Boulder Dash II - Rockford's Riot (1986)(Databyte)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.6K | |
![[ ]](/icons/compressed.gif) | Skramble (1985)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.6K | |
![[ ]](/icons/compressed.gif) | U-Boot (1985)(Manhattan Transfer)(ES)[CLOAD + RUN].zip | 2020-12-31 15:06 | 9.6K | |
![[ ]](/icons/compressed.gif) | Voidrunner (1987)(Mastertronic Added Dimension)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.6K | |
![[ ]](/icons/compressed.gif) | Battaglia delle Ardenne, La (19xx)(Philips Italy)(IT)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 9.6K | |
![[ ]](/icons/compressed.gif) | Defcom 1 (1989)(Iber Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.6K | |
![[ ]](/icons/compressed.gif) | Exerion (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.7K | |
![[ ]](/icons/compressed.gif) | Polar Star (1984)(Micro Cabin)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 9.7K | |
![[ ]](/icons/compressed.gif) | Project A (1984)(Pony Canyon)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 9.7K | |
![[ ]](/icons/compressed.gif) | Punchy (1984)(Mr. Micro)(GB)[a][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 9.7K | |
![[ ]](/icons/compressed.gif) | Exerion II - Zorni (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.7K | |
![[ ]](/icons/compressed.gif) | Polar Star (1984)(Micro Cabin)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 9.7K | |
![[ ]](/icons/compressed.gif) | Fire Rescue (1984)(Kuma Computers)(GB)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 9.8K | |
![[ ]](/icons/compressed.gif) | Fire Rescue (1984)(Kuma Computers)(GB)[a][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 9.8K | |
![[ ]](/icons/compressed.gif) | Sea King (1986)(Players Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.8K | |
![[ ]](/icons/compressed.gif) | North Sea Bullion Adventure (1985)(Kuma Computers)(GB)[CLOAD + RUN].zip | 2020-12-31 15:06 | 9.9K | |
![[ ]](/icons/compressed.gif) | M-Droid (19xx)(Blue Ribbon Software)[RUN'CAS-'].zip | 2020-12-31 15:06 | 9.9K | |
![[ ]](/icons/compressed.gif) | M-Droid (19xx)(Blue Ribbon Software)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 9.9K | |
![[ ]](/icons/compressed.gif) | Compra y Vende (1985)(Idealogic)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Jumping Jack (1986)(Livewire Software)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Visitor - Bazar Catalunya (1988)(Mind Games Espana)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Quebert (1988)(Eurosoft)(NL)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Damas (1985)(DIMensionNEW)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Deus Ex Machina (1985)(Mind Games Espana)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Ultra Chess (1985)(Aackosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Video Poker (1986)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Punchy (1984)(Mr. Micro)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Galaxian (1984)(Bug-Byte Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Gerente, El (1984)(DIMensionNEW)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Gerente, El (1984)(DIMensionNEW)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Protector, The (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Booga-Boo the Flea (1986)(Quicksilva)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Protector, The (1987)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Maze Max (1985)(Loriciels)(FR)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Booga-Boo the Flea (1986)(Quicksilva)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Snowman, The (1984)(Quicksilva)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Bounce (1987)(Methodic Solutions)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Space Rescue (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Astro Blaster (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Wamp Cola (1988)(Iber Soft)(ES)[aka Dracula][RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Fruit Panic (19xx)(Philips Spain)(ES)[CLOAD][Martos].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Astro Blaster (1988)(Eurosoft)(NL)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Magic Pinball (1987)(OMK Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 10K | |
![[ ]](/icons/compressed.gif) | Driller Tanks (19xx)(Sony Spain)(ES)(en)[BLOAD'CAS-',R][HBS-I003][Martos].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Secreto de la piramide, El (19xx)(Manhattan Transfer)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Sky Diver (1984)(Hudson Soft - Japanese Softbank)(JP)(en)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Tras el Unicornio (1987)(Azimut Soft)(ES)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Chiller (1985)(Mastertronic)(GB)[a4][RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Chiller (1985)(Mastertronic)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Chiller (1985)(Mastertronic)(GB)[a3][RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Chiller (1985)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Chiller (1985)(Mastertronic)(GB)[a5][RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Fruit Panic (1984)(Pony Canyon)(JP)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Mecom (1988)(Iber Soft)(ES)[RUN'CAS-'][aka Mekong].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Desolator (1986)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Meganova (1988)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Chiller (1985)(Mastertronic)(GB)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Happy Fret (1985)(Micro Cabin)(JP)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Warp & Warp (1984)(Bug-Byte Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Happy Fret (1985)(Micro Cabin)(JP)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Manes (1984)(ASCII)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | 737 Flight Simulator (1984)(Mirrorsoft)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | 737 Flight Simulator (1984)(Mirrorsoft)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Skyhawk (1986)(Bug-Byte Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Tank Battalion (1984)(Bug-Byte Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Gyro Adventure (1984)(Nippon Columbia - Colpax - Universal)(JP)[m playable Martos][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Firehawk (1987)(Players Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Firehawk (1987)(Players Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Ultra Chess (1985)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Dizzy Dice (1988)(Players Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Mean Streets (19xx)(Kuma Computers)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Maziacs (1985)(DK'Tronics)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Averno (1989)(Proein Soft Line)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Dizzy Balloon (1985)(Pony Canyon)(JP)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Risky Holding (1986)(DIMensionNEW)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 11K | |
![[ ]](/icons/compressed.gif) | Sky Vision (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Perico Delgado Maillot Amarillo (1989)(Topo Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Booty (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Maze Master (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | First Steps with the Mr. Men (1985)(Mirrorsoft)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Eddie Kidd Jump Challenge (1985)(Martech Games)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Roboy (1987)(Methodic Solutions)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | River Raid (1984)(Activision)(US)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Eddie Kidd Jump Challenge (1985)(Martech Games)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Checkmate! First Moves in Chess (1985)(Toshiba-EMI)(JP)[a2][needs 64k in slot 2][RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Salvage (1986)(Livewire Software)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Checkmate! First Moves in Chess (1985)(Toshiba-EMI)(JP)[needs 64k in slot 2][RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Checkmate! First Moves in Chess (1985)(Toshiba-EMI)(JP)[a][needs 64k in slot 2][RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Double Dragon (1988)(Dro Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Congo (1986)(Livewire Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Pac-Man (1984)(Bug-Byte Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Strip Poker II+ (1988)(Anco Software)(GB)(Side B)[CLOAD + RUN].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Angleball (1987)(Mastertronic Added Dimension)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Quebert (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Backgammon (1984)(Electric Software)(GB)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Vampire (1987)(Manhattan Transfer)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Splash (1986)(Mind Games Espana)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Quebert (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Joe Blade (1989)(Players Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Top Roller (19xx)(Eaglesoft)(NL)(en)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Space Rescue (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Blackjack (1985)(DIMensionNEW)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | European Games (1987)(Tynesoft)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Pitfall II - Lost Caverns (1985)(Activision)(US)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Space Rescue (1988)(Eurosoft)(NL)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Queen's Golf (1984)(ASCII)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Buck Rogers - Planet of Zoom (1983)(Sega)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Coco in the Castle (1984)(Kuma Computers)(GB)[CLOAD][Martos].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Congo Bongo (1983)(Sega)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Hopper (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Beamrider (1984)(Activision)(US)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Pastfinder (1984)(Activision)(US)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 12K | |
![[ ]](/icons/compressed.gif) | Illusions (1985)(Nice Ideas)(FR)[CLOAD + RUN].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Mutant Monty (1985)(Artic Computing)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Who Dares Wins II (1986)(Alligata Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Zond (1988)(Iber Soft)(ES)[aka Zexas][RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Kubus (1985)(Kuma Computers)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | 3D Pool. Maltese Joe's Pool Challenge (1989)(Firebird Software)(GB)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Darkwood Manor (19xx)(Kuma Computers)(GB)[CLOAD + RUN].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Darkwood Manor (19xx)(Kuma Computers)(GB)[a][CLOAD + RUN].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Dragon Slayer (1985)(Square)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Alpha Blaster (1984)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Here & There with the Mr. Men (1985)(Mirrorsoft)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Rally-X (1984)(Bug-Byte Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Rocket Roger (1987)(Alligata Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Rocket Roger (1987)(Alligata Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | North & South (1991)(Infogrames)(FR)(M3)(Side C)[RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Speed King (1986)(Mastertronic)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Speed King (1986)(Mastertronic)(GB)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Speed King (1986)(Mastertronic)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Chuckie Egg (1985)(Aackosoft)(NL)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Chuckie Egg (1984)(A & F Software)[a2][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Chuckie Egg (1984)(A & F Software)[a3][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Colt 36 (1987)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | European Games (1987)(Tynesoft)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Black Bass, The (1986)(Hot-B)(JP)[RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Champions Grand National (1984)(Pony Canyon)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Race City (1988)(Iber Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Can of Worms (1986)(Livewire Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 13K | |
![[ ]](/icons/compressed.gif) | Panzer Attack (1985)(MC Lothlorien)(GB)[CLOAD][Martos].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | European Games (1987)(Tynesoft)(GB)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | World Cup Soccer (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Panzer Attack (1985)(MC Lothlorien)(GB)[a][CLOAD][Martos].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | World Cup Soccer (1986)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Tawara (1984)(ASCII)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Confused (1986)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Starbuggy (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | 7 Card Stud (1986)(Martech Games)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Brian Jacks Superstar Challenge (1985)(Martech Games)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Ship (1989)(Eurosoft)(NL)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | 7 Card Stud (1986)(Martech Games)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | H.E.R.O. (1984)(Activision)(US)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Professional Baseball Super Simulation (1984)(JDS)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Kong (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Superbowl (1985)(Budgie Budget Software)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Desolator (1986)(Gremlin Graphics Software)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Contract Bridge (1984)(Alligata Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Tension (1988)(System 4)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Knockout (1985)(Alligata Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Chuckie Egg (1984)(A & F Software)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Super Chess (1984)(Kuma Computers)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Manic Miner (1984)(Software Projects)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Skooter (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Mystery House (1983)(Micro Cabin)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Chuckie Egg (1984)(A & F Software)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Manic Miner (1984)(Software Projects)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Dig Dug (1984)(Bug-Byte Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Tokyo Nampa Street (1986)(Enix)(JP)(Tape 1 of 2 Side B)[CLOAD][JPconfig][Martos].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Disc Warrior (1984)(Alligata Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Disc Warrior (1984)(Alligata Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Ghost (1989)(Mind Games Espana)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Spartan X (1985)(Pony Canyon)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Iron of the War (19xx)(Mind Games Espana)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Shinobi (1989)(Virgin Games)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Disc Warrior (1984)(Alligata Software)(GB)[CLOAD + RUN].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Super Chess (1984)(Kuma Computers)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Lazy Jones (1985)(Terminal Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Habilit (1988)(Iber Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Lazy Jones (1985)(Terminal Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Lazy Jones (1985)(Terminal Software)(GB)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 14K | |
![[ ]](/icons/compressed.gif) | Wing Man (1985)(Enix)(JP)(Tape 1 of 2 Side A)[CLOAD + RUN].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Molecule Man (1986)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Molecule Man (1986)(Mastertronic)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Dr. Jackle and Mr. Wide (1987)(Bulldog)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Dr. Jackle and Mr. Wide (1987)(Bulldog)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Legends - Leyendas (19xx)(Mind Games Espana)(ES)[CLOAD + RETURN].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Intrepido (1988)(Mind Games Espana)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Mappy (1984)(Bug-Byte Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Bloody (1987)(P.J. Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Running Man, The (1989)(Grandslam Entertainments)(GB)(es)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Zipi y Zape (1989)(Dro Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Confused (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Zipi y Zape (1989)(Dro Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Time Bomb (1987)(Methodic Solutions)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Decathlon (1984)(Activision)(US)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Four excitement mah-jong (1984)(Tecno Soft)(JP)[CLOAD][JPconfig][Martos].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | 10th Frame (1986)(US Gold)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Formula 1 Simulator (1985)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Formula 1 Simulator (1985)(Mastertronic)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Choro Q (1984)(Taito)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Choro Q (1984)(Taito)[b2][RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Choro Q (1984)(Taito)[b][RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Geste d'Artillac, La (1985)(Infogrames)(FR)(Tape 01 of 02)[cassette LIMINAIRE][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Heist, The (1985)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Professional Snooker Simulator (1987)(Codemasters)(GB)(M3)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Chess Player (1988)(Eurosoft)(NL)(en)[Jaque Mate][RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 15K | |
![[ ]](/icons/compressed.gif) | Speedboat Racer (1987)(Methodic Solutions)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Brian Jacks Superstar Challenge (1985)(Martech Games)(GB)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Runner (1986)(Loriciels)(FR)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Ice King, The (1986)(CDS Micro Systems)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Soul of a Robot (1987)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | North & South (1991)(Infogrames)(FR)(M3)(Side D)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Addictaball (1988)(Alligata Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Master of the Lamps (1985)(Activision)(US)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Buzz Off! (1984)(Electric Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Narco Police (1990)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Amoto's Puf (1988)(SPE)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Buzz Off! (1984)(Electric Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Buzz Off! (1984)(Electric Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Brian Jacks Superstar Challenge (1985)(Martech Games)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Silfi (1988)(Iber Soft)(ES)[copy from Elidon][RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Invierte y Gana (1986)(DIMensionNEW)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Mystery House II (1984)(Micro Cabin)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | King & Balloon (1988)(Bug-Byte Software)(GB)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Trailblazer (1986)(Gremlin Graphics Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Inca (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Tunel del tiempo, El (1986)(Mind Games Espana)(ES)[LOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Hydlide (1985)(T&E Soft)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Hydlide (1985)(T&E Soft)(JP)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Trailblazer (1986)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 16K | |
![[ ]](/icons/compressed.gif) | Galaga (1984)(Bug-Byte Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | 4x4 Off-Road Racing (1988)(US Gold)(GB)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | 4x4 Off-Road Racing (1988)(US Gold)(GB)(Side A)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Fanky Punky (1987)(P.J. Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Inca (1987)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Fanky Punky (1987)(P.J. Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Knight Ghost (1987)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Danger Mouse in The Black Forest Chateau (1986)(Alternative Software)(GB)(Side B)[CLOAD][Martos].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Chack 'n Pop (1984)(Taito)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Chack 'n Pop (1984)(Taito)[b][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Chack 'n Pop (1984)(Taito)[b2][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Danger Mouse in The Black Forest Chateau (1986)(Alternative Software)(GB)(Side A)[CLOAD][Martos].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | 747 400b Flight Simulator (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Volguard (1985)(dB-Soft)(JP)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Mazes Unlimited (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Spy Story (1986)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | 4x4 Off-Road Racing (1988)(US Gold)(GB)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Deus Ex Machina (1985)(Mind Games Espana)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Turmoil (1986)(Bug-Byte Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Turmoil (1986)(Bug-Byte Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Chopper (1986)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Spy Story (1986)(Aackosoft)(NL)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Arkanoid (1986)(Taito)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Chopper (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Chicken Chase (1986)(Bug-Byte Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Fharanx (1985)(Enix)(JP)(en-jp)[CLOAD][JPconfig][Martos].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Martianoids (1987)(Ultimate Play The Game)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 17K | |
![[ ]](/icons/compressed.gif) | Fernando Martin Basket Master (1987)(Dinamic Software)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Destroyer (1986)(Mind Games Espana)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | 180 (1987)(Mastertronic Added Dimension)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Johny Comomolo in 3-2-1 Fire (1986)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Johny Comomolo in 3-2-1 Fire (1986)(Dro Soft)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Mandragore (1986)(Infogrames)(FR)(fr)(Tape 2 of 2 Side B)[BLOAD'CAS-',R][cassette DONJONS D5-D9][Martos].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Formation Z (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Outroyd (1985)(Magical Zoo)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Barn Stormer (1985)(Electric Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Jet Fighter (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Jet Fighter (1988)(Eurosoft)(NL)(en)[a][RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Jet Fighter (1988)(Eurosoft)(NL)(en)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Elidon (1986)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Colony (1987)(Bulldog)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Cosmic Shock Absorber (1986)(Martech Games)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Elidon (1986)(Aackosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Elidon (1986)(Aackosoft)(NL)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | King Leonard (1986)(Mind Games Espana)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Legends of Star Arthur - Planet Mephius (1985)(T&E Soft)(JP)(Side A)[CLOAD + RUN].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Octagon Squad (1986)(Mastertronic)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Octagon Squad (1986)(Mastertronic)(GB)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Octagon Squad (1986)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Sabotaje (1988)(P.J. Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Sabotaje (1988)(P.J. Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Harvey Smith's Showjumper (1985)(Software Projects)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Special Operations (1985)(MC Lothlorien)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Harvey Smith's Showjumper (1985)(Software Projects)[passworded][RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Special Operations (1985)(MC Lothlorien)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Tokyo Nampa Street (1986)(Enix)(JP)(Tape 2 of 2 Side A)[CLOAD][JPconfig][Martos].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Breaker Breaker (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | City Connection (1986)(Jaleco)(JP)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | City Connection (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Whopper Chase (1987)(Erbe Software)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Tokyo Gang (1990)(G.LL. Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Police Academy II (1987)(Methodic Solutions)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Zaxxon (1985)(Electric Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 18K | |
![[ ]](/icons/compressed.gif) | Science Fiction (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Oh Shit! (1986)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | A-Team, The (1988)(Zafiro Software Division)(ES)(Side B)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Zoot (1986)(Bug-Byte Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Jet Set Willy (1984)(Software Projects)(GB)(en)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Ole! (1986)(Bug-Byte Software)(GB)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Jet Set Willy (1984)(Software Projects)(GB)(en)[m code-protection Martos][RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Altered Beast (1988)(Activision)(US)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Time Rider (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Time Rider (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Legends of Star Arthur - Planet Mephius (1985)(T&E Soft)(JP)(Side C)[CLOAD + RUN].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Beach-Head (1985)(US Gold)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Dragon Ninja (1988)(Imagine Software)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Invasion (1987)(Bulldog)(GB)[RUN'CAS-',R][64KB in Slot2][Martos].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Invasion (1987)(Bulldog)(GB)[a][RUN'CAS-'][64KB in Slot2][Martos].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Bruce Lee (1985)(Comptiq)(JP)[RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Outroyd (1985)(Magical Zoo)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | A-Team, The (1988)(Zafiro Software Division)(ES)(Side A)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Oh Shit! (1986)(Aackosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Ninja 2. Ninja Jaja Maru Kun (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Gemini Wing (1989)(Virgin Mastertronic)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Daidasso. Great Escape (1985)(Carry Lab)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 19K | |
![[ ]](/icons/compressed.gif) | Gunsmoke (1987)(Go!)(Side A)[aka Desperado][RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Desperado (1987)(Topo Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Winterhawk (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Break In (1987)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Mot (1989)(Opera Soft)(ES)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Megaphoenix (1991)(Dinamic Software)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Triple Comando (1988)(Dro Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Zoids - The Battle Begins (1985)(Martech Games)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Winterhawk (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Panel Panic (1986)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Panel Panic (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Continental Circus (1989)(Virgin Mastertronic)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Donkey Kong (1986)(Ocean Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Donkey Kong (1986)(Ocean Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Breaker Breaker (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Cid, El (1987)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | TT Racer (1987)(Methodic Solutions)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | TT Racer (1987)(Methodic Solutions)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Xyxolog. Xyzolog (1985)(Electric Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Xyxolog. Xyzolog (1985)(Electric Software)(GB)[b][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Xyxolog. Xyzolog (1985)(Electric Software)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Xyxolog. Xyzolog (1985)(Electric Software)(GB)[b2][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Memory - C.04 (1985)(Computer Users Club)(nl)[position tape + CLOAD + RUN].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Mega Chess (1988)(Iber Soft)(ES)[aka Super Chess][RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Target Plus (1988)(Dinamic Software)(ES)[gunstick][RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Abu Simbel Profanation (1986)(Dinamic Software)(ES)[a2][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Mandragore (1986)(Infogrames)(FR)(fr)(Tape 2 of 2 Side A)[BLOAD'CAS-',R][cassette DONJONS D0-D4][Martos].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Licantropo (1986)(Onaki)(ES)[RUN'CAS-'][Ultima Play The Game's Knight Lore][Martos].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Storm - Una's Lair (1986)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Storm - Una's Lair (1986)(Mastertronic)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Milk Race (1987)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Milk Race (1987)(Mastertronic)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 20K | |
![[ ]](/icons/compressed.gif) | Indiana Jones and the Temple of Doom (1987)(US Gold)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Donkey Kong (1986)(Erbe Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Macross Countdown (19xx)(Eaglesoft)[RUN'CAS-',R][Martos].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Bumpy (1989)(Loriciels)(FR)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Bumpy (1989)(Loriciels)(FR)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | B.C.'s Quest for Tires II - Grog's Revenge (1985)(US Gold)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Finders Keepers (1986)(Mastertronic)(GB)[needs 64k in slot 2][RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | B.C.'s Quest for Tires II - Grog's Revenge (1985)(US Gold)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Finders Keepers (1986)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | 007 - A View to a Kill (1986)(Domark)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | 007 - A View to a Kill (1986)(Domark)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Scentipede (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Glass (1985)(Quicksilva)(ES-GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Alien Syndrome (1988)(Dro Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Chopper One (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Post Mortem (1988)(Iber Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Abu Simbel Profanation (1986)(Dinamic Software)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Bouken Roman - Dota (1986)(Eaglesoft)(NL)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Alien 8 (1985)(Ultimate Play The Game)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Space Smugglers (1989)(MHT Ingenieros)(ES)[gunstick][RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Scramble Spirits (1990)(Grandslam Entertainments)(GB)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Shark Hunter (1984)(Electric Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Abu Simbel Profanation (1986)(Dinamic Software)(ES)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Abu Simbel Profanation (1986)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Krom - El Guerrero Invencible (1989)(OMK Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Trantor - The Last Stormtrooper (1987)(Go!)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Trantor - The Last Stormtrooper (1987)(Go!)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Trantor - The Last Stormtrooper (1987)(Go!)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Space Busters (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Lady Safary (1988)(OMK Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Adel (1986)(Mind Games Espana)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Venganza de Johny Comomolo, La (1986)(Dro Soft)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Venganza de Johny Comomolo, La (1986)(Dro Soft)(ES)[a][RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Venganza de Johny Comomolo, La (1986)(Dro Soft)(ES)[a2][RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Amaurote (1987)(Mastertronic Added Dimension)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Guttblaster (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Rescate Atlantida (1989)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Nightshade (1985)(Ultimate Play The Game)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Fernando Martin Basket Master - Executive (1987)(Dinamic Software)(ES)(en)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 21K | |
![[ ]](/icons/compressed.gif) | Way of the Tiger, The (1986)(Gremlin Graphics Software)(GB)(Tape 2 of 2 Side B)[Martos].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | B.C.'s Quest for Tires II - Grog's Revenge (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Strip Poker II+ (1988)(Anco Software)(GB)(Side A)[CLOAD + RUN].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Sootland (1988)(Zafiro Software Division)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Tritorn (1986)(Xain)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Drome (1987)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Drome (1987)(Eaglesoft)(NL)[a3][RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Drome (1987)(Eaglesoft)(NL)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Drome (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Samantha Fox Strip Poker (1986)(Martech Games)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Way of the Tiger, The (1986)(Gremlin Graphics Software)(GB)(Tape 2 of 2 Side A)[Martos].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Match Day II (1987)(Ocean Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Cosa Nostra (1986)(Opera Soft)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Starbyte (1987)(Mister Chip)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | RasterScan (1987)(Mastertronic)(GB)[RUN'CAS-',R][Martos].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | RasterScan (1987)(Mastertronic)(GB)[a][RUN'CAS-',R][Martos].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Journey to the Centre of the Earth (1985)(Bug-Byte Software)(GB)(Side B)[CLOAD + RUN].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Michel Futbol Master (1989)(Dinamic Software)(ES)(en)(Side A)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Spy vs Spy II - The Island Caper (1987)(Databyte)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Knight Lore (1985)(Ultimate Play The Game)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Le Mans (1984)(Electric Software)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Spitfire '40 (1986)(Mirrorsoft)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Pentagram (1986)(Ultimate Play The Game)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Chase H.Q. (1988)(Ocean Software)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Le Mans (1984)(Electric Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Guttblaster (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Ghostbusters (1985)(Activision)(US)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Streaker (1987)(Bulldog)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Mac Attack (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Highway Encounter (1985)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Crusader (1987)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Crusader (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Temptations (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 22K | |
![[ ]](/icons/compressed.gif) | Last Mission, The (1987)(Opera Soft)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Star Wars (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Star Wars (1986)(Eaglesoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Italia '90 - World Cup Soccer (1989)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Thor (1988)(Proein Soft Line)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Arkos I (1988)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Break In (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Rocky (1985)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Klax (1990)(Domark)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Battle Chopper (1985)(Methodic Solutions)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Rocky (1985)(Dinamic Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Mike Gunner (1988)(Dinamic Software)(ES)[RUN'CAS-'][gunstick][Martos].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Fernando Martin Basket Master - Executive (1987)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Spy vs Spy II - The Island Caper (1987)(Databyte)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Ormuz (1988)(Iber Soft)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Gemini Wing (1989)(Virgin Mastertronic)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Fernando Martin Basket Master - Executive (1987)(Dinamic Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Chessmaster 2000, The (1990)(Dro Soft)(ES)[m playable Martos][RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Dam Busters, The (1985)(Erbe Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Tokyo Nampa Street (1986)(Enix)(JP)(Tape 1 of 2 Side A)[CLOAD][JPconfig][Martos].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Gunfright (1985)(Ultimate Play The Game)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Ale Hop! (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Vera Cruz Affair, The (1986)(Infogrames)(FR)(fr)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Pac-Mania (1988)(Grandslam Entertainments)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Mundial de Futbol (1990)(Opera Soft)(ES)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Ormuz (1988)(Iber Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Gunfright (1985)(Ultimate Play The Game)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Michel Futbol Master (1989)(Dinamic Software)(ES)(en)(Side B)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | West Bank (1989)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Thexder (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | L'Heritage - Panique a Las Vegas (1987)(Idealogic)(ES)(Side B)[La herencia][Martos].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | L'Heritage - Panique a Las Vegas (19xx)(-)(en)(Side B)[Inheritance][Martos].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Police Academy (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | West Bank (1989)(Dinamic Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Indiana Jones and the Last Crusade (1989)(Erbe Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Space Shuttle - A Journey into Space (1986)(Activision)(US)[b][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Indiana Jones and the Last Crusade (1989)(Erbe Software)(ES)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | 007 - Licence to Kill (1989)(Domark)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 23K | |
![[ ]](/icons/compressed.gif) | Army Moves (1987)(Dinamic Software)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Sorcery (1985)(Virgin Games)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Army Moves (1987)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Test Drive II - The Duel (1989)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Test Drive II - The Duel (1989)(Dro Soft)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Camelot Warriors (1986)(Dinamic Software)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Journey to the Centre of the Earth (1985)(Bug-Byte Software)(GB)(Side A)[CLOAD + RUN].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Arkos II (1988)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Camelot Warriors (1986)(Dinamic Software)(ES)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Rath-Tha (1989)(Positive)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Cobra's Arc (1986)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Camelot Warriors (1986)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Star Fighter (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Solo (1989)(Opera Soft)(ES)[gunstick][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Uchi Mata (1987)(Martech Games)(GB)[CLOAD + RUN].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Uchi Mata (1987)(Martech Games)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | European Games (1987)(Tynesoft)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Khazzad-Dum (1989)(System 4)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Hypsys (1989)(Techno Arts)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Toi Acid Game (1989)(Iber Soft)(ES)(Side D)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Hypsys (1989)(Techno Arts)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Choy-Lee-Fut Kung-Fu Warrior (1990)(Positive)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Football Manager - World Cup Edition (1990)(Addictive Games)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Dawn Patrol (1987)(Eaglesoft)(NL)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Macadam Bumper (1985)(Players Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Macadam Bumper (1985)(Players Software)(GB)[a2][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Macadam Bumper (1985)(Players Software)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Samantha Fox Strip Poker (1986)(Martech Games)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Snake It (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Winter Events (1987)(Anco Software)(GB)[a][CLOAD + RUN].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Pinball Blaster (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Pinball Blaster (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Lizard (1985)(Micro Cabin)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Way of the Tiger, The (1986)(Gremlin Graphics Software)(GB)(Tape 1 of 2 Side B)[Martos].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Livingstone Supongo (1986)(Opera Soft)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Toi Acid Game (1989)(Iber Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Sirwood (1990)(Opera Soft)(ES)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Ice (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Sirwood (1990)(Opera Soft)(ES)(Side A)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Feud (1987)(Bulldog)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 24K | |
![[ ]](/icons/compressed.gif) | Mountain Bike Racer (1990)(Positive)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Footballer of the Year (1987)(Gremlin Graphics Software)(GB)[m playableMartos][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Mountain Bike Racer (1990)(Positive)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Livingstone Supongo (1986)(Opera Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Emilio Sanchez Vicario Grand Slam (1989)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Mountain Bike Racer (1990)(Positive)(ES)[a][RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Red Dawn (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Red Dawn (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Afteroids (1988)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Ace of Aces (1986)(US Gold)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Comando Tracer (1989)(Dinamic Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Afterburner (1988)(Activision)(US)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Robocop (1988)(Ocean Software)(GB)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Arquimedes XXI (1986)(Dinamic Software)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Arquimedes XXI (1986)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Zanac (1987)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Psycho Pig U.X.B. (1988)(US Gold)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Afteroids (1988)(Zigurat Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Dezeni Land (1984)(Hudson Soft)(JP)(Side C)[position tape + BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Hypsys (1989)(Techno Arts)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Krakout (1987)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Aspar GP Master (1989)(Dinamic Software)(ES)(en)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Krakout (1987)(Gremlin Graphics Software)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Meganova (1988)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Sorcery (1985)(Virgin Games)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Winter Games (1986)(US Gold)(GB)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Winter Games (1986)(US Gold)(GB)(Side A)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | African Trail Simulator (1990)(Positive)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Aspar GP Master (1988)(Dinamic Software)(ES)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Tai-Pan (1987)(Ocean Software)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Dragon Ninja (1988)(Imagine Software)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Emilio Butragueno Futbol (1988)(Topo Soft - Ocean Software)(ES-GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Dezeni Land (1984)(Hudson Soft)(JP)(Side A)[position tape + BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Operation Wolf (1988)(Ocean Software)(GB)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Panique (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 25K | |
![[ ]](/icons/compressed.gif) | Jet Bomber (1985)(Aackosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Passing Shot (1989)(Image Works)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Winter Events (1987)(Anco Software)(GB)(Side B)[Martos].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Army Moves (1987)(Dinamic Software)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Dimension Omega (1989)(Positive)(ES)(Side A)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Mad Mix Game (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Army Moves (1987)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Howard the Duck (1987)(Activision)(US)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Jaws (1989)(Screen 7)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Jet Bomber (1985)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Emilio Butragueno Futbol II (1989)(Erbe Software - Ocean Software)(ES-GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Defcom 1 (1989)(Iber Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Chicago 30's (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Arkos III (1988)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Pharaoh's Revenge (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Nonamed (1986)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Nonamed (1986)(Dinamic Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Mandragore (1986)(Infogrames)(FR)(fr)(Tape 1 of 2)[BLOAD'CAS-',R][cassette JEU][Martos].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Mandragore (1986)(Infogrames)(FR)(fr)(Tape 1 of 2)[a][BLOAD'CAS-',R][cassette JEU][Martos].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Nonamed (1986)(Dinamic Software)(ES)[a2][RUN'CAS-'][1st ed.][Martos].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Score 3020 (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Navy Moves (1988)(Dinamic Software)(ES)(Side B)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Pharaoh's Revenge (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Blow Up (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Legends of Star Arthur - Planet Mephius (1985)(T&E Soft)(JP)(Side B)[CLOAD + RUN].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Barbarian (1988)(Mastertronic)(ES-GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Corsarios (1989)(Opera Soft)(ES)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Arctic Fox (1989)(Dro Soft)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Aliens (1987)(Mr. Micro)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Michel Futbol Master (1989)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Colossus 4 Chess (1986)(CDS Microsystems)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Golden Basket (1990)(Opera Soft)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 26K | |
![[ ]](/icons/compressed.gif) | Golden Basket (1990)(Opera Soft)(ES)[passworded][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | SWIV (1991)(Dro Soft)(ES)(Side B)[needs 128k][RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Poli Diaz (1990)(Opera Soft)(ES)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Poli Diaz (1990)(Opera Soft)(ES)[m code-protection Martos][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Navy Moves (1988)(Dinamic Software)(ES)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Robot Wars (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Game Over II (1988)(Dinamic Software)(ES)(Side A)[re-release of Phantis][RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Spirits (1987)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Attacked (19xx)(Tynesoft)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Future Knight (1986)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Enchanted (1989)(Positive)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Terrorpods (1989)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Thing Bounces Back (1987)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Curro Jimenez (1989)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Titanic (1988)(Topo Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Zakil Wood (1985)(Mr. Micro)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Life in the Fast Lane (1987)(Methodic Solutions)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Phantis (1987)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Phantis (1987)(Dinamic Software)(ES)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Operation Wolf (1988)(Ocean Software)(GB)(Side A)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Vortex Raider (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Cosmic Sheriff (1989)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Blow Up (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Nuclear Bowls (1986)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Tai-Pan (1987)(Ocean Software)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Corsarios (1989)(Opera Soft)(ES)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 27K | |
![[ ]](/icons/compressed.gif) | Terminus - Prison Planet (1987)(Mastertronic Added Dimension)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Hard Boiled (1987)(Methodic Solutions)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Valkyr (1985)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Bubbler (1987)(Ultimate Play The Game)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Kong's Revenge (1991)(Zigurat Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Knight Tyme (1986)(Mastertronic Added Dimension)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Michel Futbol Master (1989)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Haunted House (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Haunted House (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Guillermo Tell (1989)(Opera Soft)(ES)[gunstick][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Future Knight (1986)(Erbe Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Pink Panther (1988)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Humphrey (1988)(Zigurat Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Pac-Land (1988)(Grandslam Entertainments)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Hammer Boy (1991)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Hammer Boy (1991)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Toi Acid Game (1989)(Iber Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Freddy Hardest (1987)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Freddy Hardest (1987)(Dinamic Software)(ES)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Titanic (1988)(Topo Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Game Over (1988)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Game Over (1988)(Dinamic Software)(ES)(en)(Side A)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Game Over (1988)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Humphrey (1988)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Bestial Warrior (1989)(Dinamic Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Game Over (1988)(Dinamic Software)(ES)(en)(Side B)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | North & South (1991)(Infogrames)(FR)(M3)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Thunderbirds (1989)(Grandslam Entertainments)(GB)(Tape 2 of 2 Side A)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Avenger (1986)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | African Trail Simulator (1990)(Positive)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Carlos Sainz (1990)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Mask III - Venom Strikes Back (1988)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Soldier of Light (1989)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Genghis Khan (1991)(Positive)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Thunderbirds (1989)(Grandslam Entertainments)(GB)(Tape 2 of 2 Side B)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Dezeni Land (1984)(Hudson Soft)(JP)(Side B)[position tape + BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Ougon no Haka. Golden Tomb. Mystery of Egypt (1984)(Magical Zoo)(JP)[CLOAD + RUN].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Thunder Blade (1988)(US Gold)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Running Man, The (1989)(Grandslam Entertainments)(GB)(es)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Dimension Omega (1989)(Positive)(ES)(Side B)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Comando Tracer (1989)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Comando Tracer (1989)(Dinamic Software)(ES)[b][RUN'CAS-'].zip | 2020-12-31 15:06 | 28K | |
![[ ]](/icons/compressed.gif) | Sol Negro (1989)(Opera Soft)(ES)(Side A)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Sol Negro (1989)(Opera Soft)(ES)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | International Karate (1986)(Endurance Games)(GB)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | International Karate (1986)(Endurance Games)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Buster Block (1985)(Kuma Computers)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Game Over II (1988)(Dinamic Software)(ES)(Side B)[re-release of Phantis][RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | International Karate (1986)(Endurance Games)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Poder Oscuro, El (1988)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Gonzzalezz (1989)(Opera Soft)(ES)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Avenger (1986)(Erbe Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Phantis (1987)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Phantis (1987)(Dinamic Software)(ES)(Side B)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Discovery (1988)(Eurosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Discovery (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Discovery (1988)(Eurosoft)(NL)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Legend (1988)(Iber Soft)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Vortex Raider (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Rescate en el Golfo (1990)(Opera Soft)(ES)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Rescate en el Golfo (1990)(Opera Soft)(ES)(Side A)[passworded][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Rescate en el Golfo (1990)(Opera Soft)(ES)(Side A)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Choy-Lee-Fut Kung-Fu Warrior (1990)(Positive)(ES)[a][RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Star Bowls (1991)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Thunderbirds (1989)(Grandslam Entertainments)(GB)(Tape 1 of 2 Side B)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Tres Luces de Glaurung, Las (1986)(Erbe Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 29K | |
![[ ]](/icons/compressed.gif) | Satan (1989)(Dinamic Software)(ES)(en)(Side B)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Satan (1989)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Thunder Blade (1988)(US Gold)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Vampire's Empire (1988)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Vampire's Empire (1988)(Dro Soft)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Cyberun (1985)(Ultimate Play The Game)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Aspar GP Master (1988)(Dinamic Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Continental Circus (1989)(Virgin Mastertronic)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Phantomas 2 (1987)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Aspar GP Master (1988)(Dinamic Software)(ES)[a3][RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Casanova (1989)(Iber Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Roma - La Conquista del Imperio (1986)(Idealogic)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Wing Man (1985)(Enix)(JP)(Tape 2 of 2 Side B)[CLOAD + RUN].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Games, The - Winter Edition (1988)(US Gold)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Blackbeard (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Jet Fighter (1985)(Aackosoft)(NL)(en)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | WEC Le Mans (1988)(Imagine Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | WEC Le Mans (1988)(Imagine Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Jai Alai (1991)(Opera Soft)(ES)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Mundial de Futbol (1990)(Opera Soft)(ES)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Hard Boiled (1987)(Methodic Solutions)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Jai Alai (1991)(Opera Soft)(ES)[m code-protection Martos][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Toi Acid Game (1989)(Iber Soft)(ES)(Side C)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Freddy Hardest (1987)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Kong's Revenge (1991)(Zigurat Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Freddy Hardest (1987)(Dinamic Software)(ES)(Side B)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Freddy Hardest (1987)(Dinamic Software)(ES)(Side B)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Buggy Ranger (1990)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Thunderbirds (1989)(Grandslam Entertainments)(GB)(Tape 1 of 2 Side A)[BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Wing Man (1985)(Enix)(JP)(Tape 2 of 2 Side A)[CLOAD + RUN].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Ulises (1989)(Opera Soft)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Bounder (1987)(Gremlin Graphics Software)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Stormbringer (1987)(Mastertronic Added Dimension)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Bounder (1987)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Scramble Spirits (1990)(Grandslam Entertainments)(GB)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Scramble Spirits (1990)(Grandslam Entertainments)(GB)(Side A)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Coliseum (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Mot (1989)(Opera Soft)(ES)(Side D)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Underground (1988)(System 4)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Sito Pons 500cc Grand Prix (1990)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Mystical (1991)(Infogrames)(FR)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Mot (1989)(Opera Soft)(ES)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 30K | |
![[ ]](/icons/compressed.gif) | Time Trax (1986)(Bug-Byte Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Time Trax (1986)(Bug-Byte Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Satan (1989)(Dinamic Software)(ES)(Side B)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Mortadelo y Filemon II - Safari Callejero (1990)(Dro Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Starquake (1986)(Bubble Bus Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Starquake (1986)(Bubble Bus Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Break Out! (1985)(Toshiba-EMI)(JP)[a2][needs 64k in slot 2][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | After the War (1989)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Break Out! (1985)(Toshiba-EMI)(JP)[a][needs 64k in slot 2][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Break Out! (1985)(Toshiba-EMI)(JP)[needs 64k in slot 2][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Don Quijote (1987)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Blasteroids (1987)(Image Works)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Professional Tennis Simulator (1990)(Dinamic Software)[aka Simulador Profesional de Tenis][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Gonzzalezz (1989)(Opera Soft)(ES)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Mortadelo y Filemon II - Safari Callejero (1990)(Dro Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Aspar GP Master (1988)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Ci-U-Than Trilogy III - Chichen Itza (1992)(Aventuras AD)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Navy Moves (1988)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Navy Moves (1988)(Dinamic Software)(ES)(en)(Side B)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Demonia (1986)(Microids)(GB)(fr)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Terramex (1988)(Grandslam Entertainments)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Hundra (1988)(Dinamic Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | After the War (1989)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Hundra (1988)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Mot (1989)(Opera Soft)(ES)(Side C)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Time Curb (1986)(Aackosoft)(NL)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Time Curb (1986)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | BMX Simulator (1987)(Codemasters)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Moon Rider (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Navy Moves (1988)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Misterio del Nilo, El (1987)(Zigurat Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Goody (1987)(Opera Soft)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Out Run (1988)(US Gold)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Goody (1987)(Opera Soft)(ES)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Out Run (1988)(US Gold)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Abracadabra (1988)(Proein Soft Line)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | 007 - The Living Daylights (1987)(Domark)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Out Run (1988)(US Gold)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Out Run (1988)(US Gold)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | 007 - The Living Daylights (1987)(Domark)(GB)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Misterio del Nilo, El (1987)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 31K | |
![[ ]](/icons/compressed.gif) | Magic Johnson's Basketball (1990)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Final Countdown (1988)(Methodic Solutions)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Amo del Mundo (1990)(Positive)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Winter Games (1986)(US Gold)(GB)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Time and Magik II - Red Moon (1985)(Level 9 Computing)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Abracadabra (1988)(Proein Soft Line)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Tokyo Nampa Street (1986)(Enix)(JP)(Tape 2 of 2 Side B)[CLOAD][JPconfig][Martos].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Poogaboo (1991)(Opera Soft)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Poogaboo (1991)(Opera Soft)(ES)[a][passworded][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Poogaboo (1991)(Opera Soft)(ES)[passworded][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Bestial Warrior (1989)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Survivor (1987)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Gilbert - Escape from Drill (1989)(Alternative Software)[RUN'CAS-',R][64KB in Slot2][Martos].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Toobin' (1989)(Domark)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Toobin' (1989)(Domark)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Obliterator (1989)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Gauntlet (1986)(US Gold)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Gauntlet (1986)(US Gold)(GB)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Mortadelo y Filemon (1988)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Teenage Mutant Hero Turtles (1990)(MCM Software)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Mambo (1989)(Positive)(ES)[a][RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Teenage Mutant Hero Turtles (1990)(MCM Software)[passworded][RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Dustin (1987)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Don Quijote (1987)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 32K | |
![[ ]](/icons/compressed.gif) | Navy Moves (1988)(Dinamic Software)(ES)(en)(Side A)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Drazen Petrovic Basket (1989)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Batman (1986)(Erbe Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Tuareg (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Mambo (1989)(Positive)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Astro Marine Corps (1989)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Dynamite Dan (1986)(Mirrorsoft)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Playhouse Strippoker (1988)(Eurosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Strip Poker II+ (1988)(Anco Software)(GB)[CLOAD + RUN].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Rock 'n Roller (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Ocean Conqueror (1987)(Mastertronic)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Metropolis (1989)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Budokan (1991)(Dro Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Astro Marine Corps (1989)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Astro Marine Corps (1989)(Dinamic Software)(ES)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Rescate en el Golfo (1990)(Opera Soft)(ES)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Rescate en el Golfo (1990)(Opera Soft)(ES)(Side B)[passworded][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Monopoly (1986)(Leisure Genius)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Turbo Girl (1988)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Turbo Girl (1988)(Dinamic Software)(ES)[a2][RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Turbo Girl (1988)(Dinamic Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | War in Middle Earth (1989)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Livingstone Supongo II (1989)(Opera Soft)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Mystical (1991)(Infogrames)(FR)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | North & South (1991)(Infogrames)(FR)(M3)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | North & South (1991)(Infogrames)(FR)(M3)(Side B)[b][RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Capitan Sevilla (1988)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Capitan Sevilla (1988)(Dinamic Software)(ES)(en)(Side A)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Mythos (1990)(Opera Soft)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Mythos (1990)(Opera Soft)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 33K | |
![[ ]](/icons/compressed.gif) | Jack the Nipper (1986)(Gremlin Graphics Software)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Wing Man (1985)(Enix)(JP)(Tape 1 of 2 Side B)[CLOAD + RUN].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Jack the Nipper (1986)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Sirwood (1990)(Opera Soft)(ES)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Livingstone Supongo II (1989)(Opera Soft)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Xenon (1988)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Ci-U-Than Trilogy II - Los Templos Sagrados (1991)(Aventuras AD)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Satan (1989)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Satan (1989)(Dinamic Software)(ES)(en)(Side A)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Mutan Zone (1989)(Opera Soft)(ES)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Mutan Zone (1989)(Opera Soft)(ES)(Side B)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Head over Heels (1987)(Ocean Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Head over Heels (1987)(Ocean Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Sirwood (1990)(Opera Soft)(ES)(Side D)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Simulador Profesional de Tenis (1990)(Dinamic Software)(ES)(en)[English edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Light Corridor, The (1990)(Infogrames)(FR)[RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Zona 0 (1991)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Cyberbig (1989)(Animagic)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Capitan Trueno (1989)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Sirwood (1990)(Opera Soft)(ES)(Side C)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Aventura Original, La (1989)(Aventuras AD)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Wizard's Lair (1986)(Bubble Bus Software)(GB)(M3)[CLOAD + RUN].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Wizard's Lair (1986)(Bubble Bus Software)(GB)(M3)[a][CLOAD + RUN].zip | 2020-12-31 15:06 | 34K | |
![[ ]](/icons/compressed.gif) | Head over Heels (1987)(Erbe Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Triple Comando (1988)(Dro Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Hunt for Red October, The (1988)(Grandslam Entertainments)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Ci-U-Than Trilogy III - Chichen Itza (1992)(Aventuras AD)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Capitan Trueno (1989)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Aventura Espacial, La (1990)(Aventuras AD)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Geste d'Artillac, La (1985)(Infogrames)(FR)(Tape 02 of 02 Side B)[cassette CHANTS - chants C7-C12][Martos].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Meganova (1988)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Capitan Sevilla (1988)(Dinamic Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Capitan Sevilla (1988)(Dinamic Software)(ES)(en)(Side B)[English Edition][RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Power and Magic (1990)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Power and Magic (1990)(Zigurat Software)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Freddy Hardest in South Manhattan (1989)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Jackson City (1990)(G.LL. Software)(ES)[RUN'CAS-'][CTRL][Martos].zip | 2020-12-31 15:06 | 35K | |
![[ ]](/icons/compressed.gif) | Mutan Zone (1989)(Opera Soft)(ES)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 36K | |
![[ ]](/icons/compressed.gif) | Mutan Zone (1989)(Opera Soft)(ES)(Side A)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 36K | |
![[ ]](/icons/compressed.gif) | Wells & Fargo (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 36K | |
![[ ]](/icons/compressed.gif) | Xybots (1989)(Domark)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 36K | |
![[ ]](/icons/compressed.gif) | Xybots (1989)(Domark)(GB)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 36K | |
![[ ]](/icons/compressed.gif) | Smack Wacker (1986)(Eaglesoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 36K | |
![[ ]](/icons/compressed.gif) | Aventura Espacial, La (1990)(Aventuras AD)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 36K | |
![[ ]](/icons/compressed.gif) | Chuck Yeager's Advanced Flight Trainer (1989)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 36K | |
![[ ]](/icons/compressed.gif) | Tour 91 (1991)(Topo Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 36K | |
![[ ]](/icons/compressed.gif) | R.A.M. (1990)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 36K | |
![[ ]](/icons/compressed.gif) | Ci-U-Than Trilogy II - Los Templos Sagrados (1991)(Aventuras AD)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 37K | |
![[ ]](/icons/compressed.gif) | Karateka (1986)(Dro Soft)(ES)(Side A)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 37K | |
![[ ]](/icons/compressed.gif) | Jungle Warrior (1990)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 37K | |
![[ ]](/icons/compressed.gif) | Comando Quatro (1989)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 37K | |
![[ ]](/icons/compressed.gif) | Jabato (1989)(Aventuras AD)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 37K | |
![[ ]](/icons/compressed.gif) | Jet Set Willy II - The Final Frontier (1985)(Software Projects)[RUN'CAS-'].zip | 2020-12-31 15:06 | 37K | |
![[ ]](/icons/compressed.gif) | Jet Set Willy II - The Final Frontier (1985)(Software Projects)[passworded][RUN'CAS-'].zip | 2020-12-31 15:06 | 37K | |
![[ ]](/icons/compressed.gif) | Smaily (1990)(Zigurat Software)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 37K | |
![[ ]](/icons/compressed.gif) | Made in Spain - 5 Estrellas (1985)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 37K | |
![[ ]](/icons/compressed.gif) | Aventura Original, La (1989)(Aventuras AD)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 37K | |
![[ ]](/icons/compressed.gif) | SWIV (1991)(Dro Soft)(ES)(Side A)[needs 128k][RUN'CAS-'].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | SWIV (1991)(Dro Soft)(ES)(Side A)[a][needs 128k][RUN'CAS-'].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Jabato (1989)(Aventuras AD)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Senda Salvaje (1990)(Zigurat Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | North Sea Helicopter (1987)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Mundo Perdido, El (1988)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Afterburner (1988)(Activision)(US)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Mad Mix 2 - En el Castillo de los Fantasmas (1990)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Afterburner (1988)(Activision)(US)(Side A)[m playable Martos][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | California Games (1987)(US Gold)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Robocop (1988)(Ocean Software)(GB)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Peter Beardsley's International Football (1988)(Grandslam Entertainments)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Mask II (1987)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Death Wish 3 (1987)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Senda Salvaje (1990)(Zigurat Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Budokan (1991)(Dro Soft)(ES)(Side D)[RUN'CAS-'].zip | 2020-12-31 15:06 | 38K | |
![[ ]](/icons/compressed.gif) | Flintstones, The (1988)(Grandslam Entertainments)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 39K | |
![[ ]](/icons/compressed.gif) | Ci-U-Than Trilogy I - La Diosa de Cozumel (1990)(Aventuras AD)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 39K | |
![[ ]](/icons/compressed.gif) | Ci-U-Than Trilogy I - La Diosa de Cozumel (1990)(Aventuras AD)(ES)(Side B)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 39K | |
![[ ]](/icons/compressed.gif) | Alien Syndrome (1988)(Dro Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 39K | |
![[ ]](/icons/compressed.gif) | Sir Fred (1986)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 39K | |
![[ ]](/icons/compressed.gif) | Paris-Dakar (1988)(Zigurat Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 39K | |
![[ ]](/icons/compressed.gif) | Ci-U-Than Trilogy I - La Diosa de Cozumel (1990)(Aventuras AD)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 40K | |
![[ ]](/icons/compressed.gif) | Ci-U-Than Trilogy I - La Diosa de Cozumel (1990)(Aventuras AD)(ES)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 40K | |
![[ ]](/icons/compressed.gif) | Saint Dragon (1990)(Dro Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 40K | |
![[ ]](/icons/compressed.gif) | Soviet (1990)(Opera Soft)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 40K | |
![[ ]](/icons/compressed.gif) | Tom & Jerry (1989)(Erbe Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 40K | |
![[ ]](/icons/compressed.gif) | Auf Wiedersehen Monty (1987)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 40K | |
![[ ]](/icons/compressed.gif) | Time Out (1988)(Zafiro Software Division)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 40K | |
![[ ]](/icons/compressed.gif) | Oberon 69 (1990)(G.LL. Software)(ES)[RUN'CAS-'][CTRL][Martos].zip | 2020-12-31 15:06 | 40K | |
![[ ]](/icons/compressed.gif) | Sol Negro (1989)(Opera Soft)(ES)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | Sol Negro (1989)(Opera Soft)(ES)(Side B)[a2][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | Sol Negro (1989)(Opera Soft)(ES)(Side B)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | Angel Nieto Pole 500cc (1990)(Opera Soft)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | Dragon Ninja (1988)(Imagine Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | Robocop (1988)(Ocean Software)(GB)(Side A)[a][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | Buran (1990)(OMK Software)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | Ice-Breaker (1990)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | Flash Gordon (1987)(Mastertronic Added Dimension)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | Jack the Nipper II - In Coconut Capers (1987)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | Geste d'Artillac, La (1985)(Infogrames)(FR)(Tape 02 of 02 Side A)[cassette CHANTS - chants C1-C6][Martos].zip | 2020-12-31 15:06 | 41K | |
![[ ]](/icons/compressed.gif) | California Games (1987)(US Gold)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 42K | |
![[ ]](/icons/compressed.gif) | Flight Deck II (1986)(Aackosoft)(NL)[RUN'CAS-'].zip | 2020-12-31 15:06 | 42K | |
![[ ]](/icons/compressed.gif) | Operation Wolf (1988)(Ocean Software)(GB)(Side B)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 42K | |
![[ ]](/icons/compressed.gif) | Operation Wolf (1988)(Ocean Software)(GB)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 42K | |
![[ ]](/icons/compressed.gif) | Gauntlet (1986)(US Gold)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 43K | |
![[ ]](/icons/compressed.gif) | Rambo III (1988)(Ocean Software)(GB)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 43K | |
![[ ]](/icons/compressed.gif) | Power Drift (1989)(Activision)(US)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 43K | |
![[ ]](/icons/compressed.gif) | Indiana Jones and the Last Crusade (1989)(Erbe Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 43K | |
![[ ]](/icons/compressed.gif) | Elite (1987)(Firebird Software)(GB)(GB)[m playable Martos][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 43K | |
![[ ]](/icons/compressed.gif) | Ke Rulen los Petas (1989)(Iber Soft)(ES)[b][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 44K | |
![[ ]](/icons/compressed.gif) | Ke Rulen los Petas (1989)(Iber Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 44K | |
![[ ]](/icons/compressed.gif) | Harry Fox Yki no Maoh (1985)(Micro Cabin)(JP)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 44K | |
![[ ]](/icons/compressed.gif) | Desperado 2 (1991)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 44K | |
![[ ]](/icons/compressed.gif) | Desperado 2 (1991)(Topo Soft)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 44K | |
![[ ]](/icons/compressed.gif) | Sabrina (1989)(Iber Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 44K | |
![[ ]](/icons/compressed.gif) | Shinobi (1989)(Virgin Games)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 45K | |
![[ ]](/icons/compressed.gif) | Renegade III - The Final Chapter (1989)(Imagine Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 46K | |
![[ ]](/icons/compressed.gif) | Zarth (1985)(Enix)(JP)(Side B)[CLOAD + RUN].zip | 2020-12-31 15:06 | 46K | |
![[ ]](/icons/compressed.gif) | Narco Police (1990)(Dinamic Software)(ES)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 46K | |
![[ ]](/icons/compressed.gif) | Saint Dragon (1990)(Dro Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 48K | |
![[ ]](/icons/compressed.gif) | Soviet (1990)(Opera Soft)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 48K | |
![[ ]](/icons/compressed.gif) | Games, The - Winter Edition (1988)(US Gold)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 49K | |
![[ ]](/icons/compressed.gif) | Winter Events (1987)(Anco Software)(GB)[CLOAD].zip | 2020-12-31 15:06 | 49K | |
![[ ]](/icons/compressed.gif) | Saint Dragon (1990)(Dro Soft)(ES)(Side B)[b][RUN'CAS-'].zip | 2020-12-31 15:06 | 49K | |
![[ ]](/icons/compressed.gif) | Stardust (1987)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 50K | |
![[ ]](/icons/compressed.gif) | L'Heritage - Panique a Las Vegas (1987)(Idealogic)(ES)(Side A)[La herencia][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 51K | |
![[ ]](/icons/compressed.gif) | L'Heritage - Panique a Las Vegas (19xx)(-)(en)(Side A)[Inheritance][BLOAD'CAS-',R][Martos].zip | 2020-12-31 15:06 | 51K | |
![[ ]](/icons/compressed.gif) | Tour 91 (1991)(Topo Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 51K | |
![[ ]](/icons/compressed.gif) | Rambo III (1988)(Ocean Software)(GB)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 51K | |
![[ ]](/icons/compressed.gif) | Rambo III (1988)(Ocean Software)(GB)(Side A)[a][BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 51K | |
![[ ]](/icons/compressed.gif) | Gunsmoke (1987)(Go!)(Side B)[aka Desperado][RUN'CAS-'].zip | 2020-12-31 15:06 | 52K | |
![[ ]](/icons/compressed.gif) | Desperado (1987)(Topo Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 52K | |
![[ ]](/icons/compressed.gif) | Chase H.Q. (1988)(Ocean Software)(GB)(Side A)[b][RUN'CAS-'].zip | 2020-12-31 15:06 | 52K | |
![[ ]](/icons/compressed.gif) | Chase H.Q. (1988)(Ocean Software)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 52K | |
![[ ]](/icons/compressed.gif) | Emilio Butragueno Futbol II (1989)(Erbe Software - Ocean Software)(ES-GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 53K | |
![[ ]](/icons/compressed.gif) | Rescate Atlantida (1989)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 53K | |
![[ ]](/icons/compressed.gif) | World Games (1987)(US Gold)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 53K | |
![[ ]](/icons/compressed.gif) | Narco Police (1990)(Dinamic Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 53K | |
![[ ]](/icons/compressed.gif) | Aaargh! (1989)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 57K | |
![[ ]](/icons/compressed.gif) | Aaargh! (1989)(Dro Soft)(ES)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 57K | |
![[ ]](/icons/compressed.gif) | Batman (1986)(Ocean Software)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 58K | |
![[ ]](/icons/compressed.gif) | Batman (1986)(Ocean Software)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 58K | |
![[ ]](/icons/compressed.gif) | Time Scanner (1989)(Activision)(US)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 59K | |
![[ ]](/icons/compressed.gif) | Perico Delgado Maillot Amarillo (1989)(Topo Soft)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 60K | |
![[ ]](/icons/compressed.gif) | Duck out (1989)(Dro Soft)(ES)[RUN'CAS-'][Martos].zip | 2020-12-31 15:06 | 60K | |
![[ ]](/icons/compressed.gif) | World Games (1987)(US Gold)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 60K | |
![[ ]](/icons/compressed.gif) | Bronx (1989)(Animagic)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 62K | |
![[ ]](/icons/compressed.gif) | Abadia del Crimen, La (1988)(Opera Soft)(ES)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 62K | |
![[ ]](/icons/compressed.gif) | Batman - The Movie (1989)(Ocean Software)(GB)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 63K | |
![[ ]](/icons/compressed.gif) | Double Dragon (1988)(Dro Soft)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 64K | |
![[ ]](/icons/compressed.gif) | Double Dragon II - The Revenge (1990)(Dro Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 64K | |
![[ ]](/icons/compressed.gif) | Hostages (1990)(Erbe)(ES)(en)(m Martos)[RUN'CAS-'].zip | 2020-12-31 15:06 | 67K | |
![[ ]](/icons/compressed.gif) | Lorna (1990)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 67K | |
![[ ]](/icons/compressed.gif) | Hercules - Slayer of the Damned (1988)(Gremlin Graphics Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 67K | |
![[ ]](/icons/compressed.gif) | Operation Wolf (1988)(Ocean Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 67K | |
![[ ]](/icons/compressed.gif) | Silent Shadow (1988)(Topo Soft)[RUN'CAS-'].zip | 2020-12-31 15:06 | 68K | |
![[ ]](/icons/compressed.gif) | Barbarian II - The Dungeon of Drax (1988)(Erbe Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 68K | |
![[ ]](/icons/compressed.gif) | Zarth (1985)(Enix)(JP)(Side A)[CLOAD + RUN].zip | 2020-12-31 15:06 | 68K | |
![[ ]](/icons/compressed.gif) | Untouchables, The (1989)(Erbe Software)(ES)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 70K | |
![[ ]](/icons/compressed.gif) | Rescate Atlantida (1989)(Dinamic Software)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 72K | |
![[ ]](/icons/compressed.gif) | Batman - The Movie (1989)(Ocean Software)(GB)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 75K | |
![[ ]](/icons/compressed.gif) | Relics (1986)(Bothtec)(JP)(Side B)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 82K | |
![[ ]](/icons/compressed.gif) | Viaje al Centro de la Tierra (1989)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 82K | |
![[ ]](/icons/compressed.gif) | Untouchables, The (1989)(Erbe Software)(ES)(Side A)[RUN'CAS-'].zip | 2020-12-31 15:06 | 86K | |
![[ ]](/icons/compressed.gif) | Untouchables, The (1989)(Erbe Software)(ES)(Side A)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 86K | |
![[ ]](/icons/compressed.gif) | Altered Beast (1988)(Activision)(US)(Side B)[RUN'CAS-'].zip | 2020-12-31 15:06 | 88K | |
![[ ]](/icons/compressed.gif) | Relics (1986)(Bothtec)(JP)(Side A)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 89K | |
![[ ]](/icons/compressed.gif) | Ghostbusters II (1989)(Activision)(US)[RUN'CAS-'].zip | 2020-12-31 15:06 | 90K | |
![[ ]](/icons/compressed.gif) | Rambo III (1988)(Ocean Software)(GB)[BLOAD'CAS-',R].zip | 2020-12-31 15:06 | 93K | |
![[ ]](/icons/compressed.gif) | Moonwalker (1989)(US Gold)(GB)[RUN'CAS-'].zip | 2020-12-31 15:06 | 99K | |
![[ ]](/icons/compressed.gif) | Moonwalker (1989)(US Gold)(GB)[a][RUN'CAS-'].zip | 2020-12-31 15:06 | 99K | |
![[ ]](/icons/compressed.gif) | Gremlins 2 - La Nueva Generacion (1990)(Topo Soft)(ES)[RUN'CAS-'].zip | 2020-12-31 15:06 | 106K | |
|